C9H6F5N3 — CID 81136910
5-methyl-2-(1,1,2,2,2-pentafluoroethyl)-1H-imidazo[4,5-b]pyridine (PubChem CID 81136910) has the molecular formula C9H6F5N3 and a molecular weight of 251.16 g/mol. Its IUPAC name is 5-methyl-2-(1,1,2,2,2-pentafluoroethyl)-1H-imidazo[4,5-b]pyridine.
| Compound Name | 5-methyl-2-(1,1,2,2,2-pentafluoroethyl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 81136910 |
| Molecular Formula | C9H6F5N3 |
| Molecular Weight | 251.16 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 5-methyl-2-(1,1,2,2,2-pentafluoroethyl)-1H-imidazo[4,5-b]pyridine |
| SMILES | Cc1ccc2[nH]c(C(F)(F)C(F)(F)F)nc2n1 |
| InChI | InChI=1S/C9H6F5N3/c1-4-2-3-5-6(15-4)17-7(16-5)8(10,11)9(12,13)14/h2-3H,1H3,(H,15,16,17) |
| InChIKey | BHIJGKFULQZNMJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.16 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|