About ethyl 2-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-hydroxyacetate
ethyl 2-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-hydroxyacetate (PubChem CID 81137214) has the molecular formula C15H20O4
and a molecular weight of 264.32 g/mol. Its IUPAC name is ethyl 2-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-hydroxyacetate.
Molecular Properties
| Compound Name | ethyl 2-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-hydroxyacetate |
| PubChem CID | 81137214 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | ethyl 2-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)C1CC(C)(C)Oc2ccccc21 |
| InChI | InChI=1S/C15H20O4/c1-4-18-14(17)13(16)11-9-15(2,3)19-12-8-6-5-7-10(11)12/h5-8,11,13,16H,4,9H2,1-3H3 |
| InChIKey | GAVYPOUJHISIKJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-hydroxyacetate?
The IUPAC name of ethyl 2-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-hydroxyacetate (CID 81137214) is ethyl 2-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-hydroxyacetate.
What is the SMILES notation for ethyl 2-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-hydroxyacetate?
The canonical SMILES for ethyl 2-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-hydroxyacetate is CCOC(=O)C(O)C1CC(C)(C)Oc2ccccc21.
What is the InChIKey of ethyl 2-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-hydroxyacetate?
The InChIKey is GAVYPOUJHISIKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O4/c1-4-18-14(17)13(16)11-9-15(2,3)19-12-8-6-5-7-10(11)12/h5-8,11,13,16H,4,9H2,1-3H3.
What are the key properties of ethyl 2-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-hydroxyacetate?
ethyl 2-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-hydroxyacetate has a molecular weight of 264.32 g/mol, XLogP of 2.26, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-hydroxyacetate is sourced from PubChem (CID 81137214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).