About N-tert-butyl-4,4-dimethyl-1H-chromeno[3,4-d]pyrazol-3-amine
N-tert-butyl-4,4-dimethyl-1H-chromeno[3,4-d]pyrazol-3-amine (PubChem CID 81137569) has the molecular formula C16H21N3O
and a molecular weight of 271.36 g/mol. Its IUPAC name is N-tert-butyl-4,4-dimethyl-1H-chromeno[3,4-d]pyrazol-3-amine.
Molecular Properties
| Compound Name | N-tert-butyl-4,4-dimethyl-1H-chromeno[3,4-d]pyrazol-3-amine |
| PubChem CID | 81137569 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | N-tert-butyl-4,4-dimethyl-1H-chromeno[3,4-d]pyrazol-3-amine |
| SMILES | CC(C)(C)Nc1n[nH]c2c1C(C)(C)Oc1ccccc1-2 |
| InChI | InChI=1S/C16H21N3O/c1-15(2,3)17-14-12-13(18-19-14)10-8-6-7-9-11(10)20-16(12,4)5/h6-9H,1-5H3,(H2,17,18,19) |
| InChIKey | OCERZRXSGDPWGN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-4,4-dimethyl-1H-chromeno[3,4-d]pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-4,4-dimethyl-1H-chromeno[3,4-d]pyrazol-3-amine?
The IUPAC name of N-tert-butyl-4,4-dimethyl-1H-chromeno[3,4-d]pyrazol-3-amine (CID 81137569) is N-tert-butyl-4,4-dimethyl-1H-chromeno[3,4-d]pyrazol-3-amine.
What is the SMILES notation for N-tert-butyl-4,4-dimethyl-1H-chromeno[3,4-d]pyrazol-3-amine?
The canonical SMILES for N-tert-butyl-4,4-dimethyl-1H-chromeno[3,4-d]pyrazol-3-amine is CC(C)(C)Nc1n[nH]c2c1C(C)(C)Oc1ccccc1-2.
What is the InChIKey of N-tert-butyl-4,4-dimethyl-1H-chromeno[3,4-d]pyrazol-3-amine?
The InChIKey is OCERZRXSGDPWGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O/c1-15(2,3)17-14-12-13(18-19-14)10-8-6-7-9-11(10)20-16(12,4)5/h6-9H,1-5H3,(H2,17,18,19).
What are the key properties of N-tert-butyl-4,4-dimethyl-1H-chromeno[3,4-d]pyrazol-3-amine?
N-tert-butyl-4,4-dimethyl-1H-chromeno[3,4-d]pyrazol-3-amine has a molecular weight of 271.36 g/mol, XLogP of 3.91, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-4,4-dimethyl-1H-chromeno[3,4-d]pyrazol-3-amine is sourced from PubChem (CID 81137569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).