About 2-methoxy-5-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline
2-methoxy-5-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline (PubChem CID 81137784) has the molecular formula C14H14N4O
and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-methoxy-5-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline.
Molecular Properties
| Compound Name | 2-methoxy-5-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline |
| PubChem CID | 81137784 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-methoxy-5-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline |
| SMILES | COc1ccc(-c2nc3nc(C)ccc3[nH]2)cc1N |
| InChI | InChI=1S/C14H14N4O/c1-8-3-5-11-14(16-8)18-13(17-11)9-4-6-12(19-2)10(15)7-9/h3-7H,15H2,1-2H3,(H,16,17,18) |
| InChIKey | IDGVEBPUFYVYHI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-5-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-5-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline?
The IUPAC name of 2-methoxy-5-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline (CID 81137784) is 2-methoxy-5-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline.
What is the SMILES notation for 2-methoxy-5-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline?
The canonical SMILES for 2-methoxy-5-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline is COc1ccc(-c2nc3nc(C)ccc3[nH]2)cc1N.
What is the InChIKey of 2-methoxy-5-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline?
The InChIKey is IDGVEBPUFYVYHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O/c1-8-3-5-11-14(16-8)18-13(17-11)9-4-6-12(19-2)10(15)7-9/h3-7H,15H2,1-2H3,(H,16,17,18).
What are the key properties of 2-methoxy-5-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline?
2-methoxy-5-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline has a molecular weight of 254.29 g/mol, XLogP of 2.52, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)aniline is sourced from PubChem (CID 81137784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).