C13H10Br2N4 — CID 81138625
3-(2,5-dibromophenyl)-5-methylimidazo[4,5-b]pyridin-2-amine (PubChem CID 81138625) has the molecular formula C13H10Br2N4 and a molecular weight of 382.06 g/mol. Its IUPAC name is 3-(2,5-dibromophenyl)-5-methylimidazo[4,5-b]pyridin-2-amine.
| Compound Name | 3-(2,5-dibromophenyl)-5-methylimidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 81138625 |
| Molecular Formula | C13H10Br2N4 |
| Molecular Weight | 382.06 g/mol |
| Exact Mass | 379.93 |
| IUPAC Name | 3-(2,5-dibromophenyl)-5-methylimidazo[4,5-b]pyridin-2-amine |
| SMILES | Cc1ccc2nc(N)n(-c3cc(Br)ccc3Br)c2n1 |
| InChI | InChI=1S/C13H10Br2N4/c1-7-2-5-10-12(17-7)19(13(16)18-10)11-6-8(14)3-4-9(11)15/h2-6H,1H3,(H2,16,18) |
| InChIKey | MEFGFTXJGYFIRT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.06 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |