About 2,2-dimethyl-N-(4-methylsulfanylphenyl)-3,4-dihydrochromen-4-amine
2,2-dimethyl-N-(4-methylsulfanylphenyl)-3,4-dihydrochromen-4-amine (PubChem CID 81139369) has the molecular formula C18H21NOS
and a molecular weight of 299.44 g/mol. Its IUPAC name is 2,2-dimethyl-N-(4-methylsulfanylphenyl)-3,4-dihydrochromen-4-amine.
Molecular Properties
| Compound Name | 2,2-dimethyl-N-(4-methylsulfanylphenyl)-3,4-dihydrochromen-4-amine |
| PubChem CID | 81139369 |
| Molecular Formula | C18H21NOS |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2,2-dimethyl-N-(4-methylsulfanylphenyl)-3,4-dihydrochromen-4-amine |
| SMILES | CSc1ccc(NC2CC(C)(C)Oc3ccccc32)cc1 |
| InChI | InChI=1S/C18H21NOS/c1-18(2)12-16(15-6-4-5-7-17(15)20-18)19-13-8-10-14(21-3)11-9-13/h4-11,16,19H,12H2,1-3H3 |
| InChIKey | KKEXSZPZHAXZQJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dimethyl-N-(4-methylsulfanylphenyl)-3,4-dihydrochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-N-(4-methylsulfanylphenyl)-3,4-dihydrochromen-4-amine?
The IUPAC name of 2,2-dimethyl-N-(4-methylsulfanylphenyl)-3,4-dihydrochromen-4-amine (CID 81139369) is 2,2-dimethyl-N-(4-methylsulfanylphenyl)-3,4-dihydrochromen-4-amine.
What is the SMILES notation for 2,2-dimethyl-N-(4-methylsulfanylphenyl)-3,4-dihydrochromen-4-amine?
The canonical SMILES for 2,2-dimethyl-N-(4-methylsulfanylphenyl)-3,4-dihydrochromen-4-amine is CSc1ccc(NC2CC(C)(C)Oc3ccccc32)cc1.
What is the InChIKey of 2,2-dimethyl-N-(4-methylsulfanylphenyl)-3,4-dihydrochromen-4-amine?
The InChIKey is KKEXSZPZHAXZQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NOS/c1-18(2)12-16(15-6-4-5-7-17(15)20-18)19-13-8-10-14(21-3)11-9-13/h4-11,16,19H,12H2,1-3H3.
What are the key properties of 2,2-dimethyl-N-(4-methylsulfanylphenyl)-3,4-dihydrochromen-4-amine?
2,2-dimethyl-N-(4-methylsulfanylphenyl)-3,4-dihydrochromen-4-amine has a molecular weight of 299.44 g/mol, XLogP of 5.12, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-N-(4-methylsulfanylphenyl)-3,4-dihydrochromen-4-amine is sourced from PubChem (CID 81139369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).