C16H12N4S — CID 81139416
5-methyl-3-quinolin-8-yl-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 81139416) has the molecular formula C16H12N4S and a molecular weight of 292.37 g/mol. Its IUPAC name is 5-methyl-3-quinolin-8-yl-1H-imidazo[4,5-b]pyridine-2-thione.
| Compound Name | 5-methyl-3-quinolin-8-yl-1H-imidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 81139416 |
| Molecular Formula | C16H12N4S |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 5-methyl-3-quinolin-8-yl-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | Cc1ccc2[nH]c(=S)n(-c3cccc4cccnc34)c2n1 |
| InChI | InChI=1S/C16H12N4S/c1-10-7-8-12-15(18-10)20(16(21)19-12)13-6-2-4-11-5-3-9-17-14(11)13/h2-9H,1H3,(H,19,21) |
| InChIKey | MLZAAIVGWBGZIK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|