C15H21N5O — CID 81140466
3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-5-methylimidazo[4,5-b]pyridin-2-amine (PubChem CID 81140466) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-5-methylimidazo[4,5-b]pyridin-2-amine.
| Compound Name | 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-5-methylimidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 81140466 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-5-methylimidazo[4,5-b]pyridin-2-amine |
| SMILES | Cc1ccc2nc(N)n(CC3CN4CCCC4CO3)c2n1 |
| InChI | InChI=1S/C15H21N5O/c1-10-4-5-13-14(17-10)20(15(16)18-13)8-12-7-19-6-2-3-11(19)9-21-12/h4-5,11-12H,2-3,6-9H2,1H3,(H2,16,18) |
| InChIKey | SOWPNIBTQVLJNI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |