About 2,2-dimethylspiro[3H-chromene-4,3'-piperazine]-2'-one
2,2-dimethylspiro[3H-chromene-4,3'-piperazine]-2'-one (PubChem CID 81142185) has the molecular formula C14H18N2O2
and a molecular weight of 246.31 g/mol. Its IUPAC name is 2,2-dimethylspiro[3H-chromene-4,3'-piperazine]-2'-one.
Molecular Properties
| Compound Name | 2,2-dimethylspiro[3H-chromene-4,3'-piperazine]-2'-one |
| PubChem CID | 81142185 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2,2-dimethylspiro[3H-chromene-4,3'-piperazine]-2'-one |
| SMILES | CC1(C)CC2(NCCNC2=O)c2ccccc2O1 |
| InChI | InChI=1S/C14H18N2O2/c1-13(2)9-14(12(17)15-7-8-16-14)10-5-3-4-6-11(10)18-13/h3-6,16H,7-9H2,1-2H3,(H,15,17) |
| InChIKey | XSWTZGJOSPLSAS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dimethylspiro[3H-chromene-4,3'-piperazine]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylspiro[3H-chromene-4,3'-piperazine]-2'-one?
The IUPAC name of 2,2-dimethylspiro[3H-chromene-4,3'-piperazine]-2'-one (CID 81142185) is 2,2-dimethylspiro[3H-chromene-4,3'-piperazine]-2'-one.
What is the SMILES notation for 2,2-dimethylspiro[3H-chromene-4,3'-piperazine]-2'-one?
The canonical SMILES for 2,2-dimethylspiro[3H-chromene-4,3'-piperazine]-2'-one is CC1(C)CC2(NCCNC2=O)c2ccccc2O1.
What is the InChIKey of 2,2-dimethylspiro[3H-chromene-4,3'-piperazine]-2'-one?
The InChIKey is XSWTZGJOSPLSAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2/c1-13(2)9-14(12(17)15-7-8-16-14)10-5-3-4-6-11(10)18-13/h3-6,16H,7-9H2,1-2H3,(H,15,17).
What are the key properties of 2,2-dimethylspiro[3H-chromene-4,3'-piperazine]-2'-one?
2,2-dimethylspiro[3H-chromene-4,3'-piperazine]-2'-one has a molecular weight of 246.31 g/mol, XLogP of 1.16, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylspiro[3H-chromene-4,3'-piperazine]-2'-one is sourced from PubChem (CID 81142185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).