C15H17NO3 — CID 81142189
3-(2,2-dimethyl-3,4-dihydrochromen-4-yl)pyrrolidine-2,5-dione (PubChem CID 81142189) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is 3-(2,2-dimethyl-3,4-dihydrochromen-4-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-(2,2-dimethyl-3,4-dihydrochromen-4-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 81142189 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 3-(2,2-dimethyl-3,4-dihydrochromen-4-yl)pyrrolidine-2,5-dione |
| SMILES | CC1(C)CC(C2CC(=O)NC2=O)c2ccccc2O1 |
| InChI | InChI=1S/C15H17NO3/c1-15(2)8-11(10-7-13(17)16-14(10)18)9-5-3-4-6-12(9)19-15/h3-6,10-11H,7-8H2,1-2H3,(H,16,17,18) |
| InChIKey | YBUHSOHCXFPOCB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|