C14H11ClFN3O — CID 81143259
5-[(3-chloro-4-fluorophenyl)methylamino]-1,3-dihydrobenzimidazol-2-one (PubChem CID 81143259) has the molecular formula C14H11ClFN3O and a molecular weight of 291.71 g/mol. Its IUPAC name is 5-[(3-chloro-4-fluorophenyl)methylamino]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[(3-chloro-4-fluorophenyl)methylamino]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 81143259 |
| Molecular Formula | C14H11ClFN3O |
| Molecular Weight | 291.71 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 5-[(3-chloro-4-fluorophenyl)methylamino]-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(NCc3ccc(F)c(Cl)c3)cc2[nH]1 |
| InChI | InChI=1S/C14H11ClFN3O/c15-10-5-8(1-3-11(10)16)7-17-9-2-4-12-13(6-9)19-14(20)18-12/h1-6,17H,7H2,(H2,18,19,20) |
| InChIKey | OXIZZRZPRCMYQG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.71 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_A(5)', 'substructure': 'N/A'} |
|---|