C17H29ClN2O — CID 81143287
3-[2-chloro-4-[(2-methylpropylamino)methyl]-N-propan-2-ylanilino]propan-1-ol (PubChem CID 81143287) has the molecular formula C17H29ClN2O and a molecular weight of 312.89 g/mol. Its IUPAC name is 3-[2-chloro-4-[(2-methylpropylamino)methyl]-N-propan-2-ylanilino]propan-1-ol.
| Compound Name | 3-[2-chloro-4-[(2-methylpropylamino)methyl]-N-propan-2-ylanilino]propan-1-ol |
|---|---|
| PubChem CID | 81143287 |
| Molecular Formula | C17H29ClN2O |
| Molecular Weight | 312.89 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 3-[2-chloro-4-[(2-methylpropylamino)methyl]-N-propan-2-ylanilino]propan-1-ol |
| SMILES | CC(C)CNCc1ccc(N(CCCO)C(C)C)c(Cl)c1 |
| InChI | InChI=1S/C17H29ClN2O/c1-13(2)11-19-12-15-6-7-17(16(18)10-15)20(14(3)4)8-5-9-21/h6-7,10,13-14,19,21H,5,8-9,11-12H2,1-4H3 |
| InChIKey | OQTFHJFVPUNVOK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.89 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|