About 2-thieno[3,2-b]pyridin-6-yl-6,7-dihydro-5H-1,3-benzothiazol-4-one
2-thieno[3,2-b]pyridin-6-yl-6,7-dihydro-5H-1,3-benzothiazol-4-one (PubChem CID 81143321) has the molecular formula C14H10N2OS2
and a molecular weight of 286.38 g/mol. Its IUPAC name is 2-thieno[3,2-b]pyridin-6-yl-6,7-dihydro-5H-1,3-benzothiazol-4-one.
Molecular Properties
| Compound Name | 2-thieno[3,2-b]pyridin-6-yl-6,7-dihydro-5H-1,3-benzothiazol-4-one |
| PubChem CID | 81143321 |
| Molecular Formula | C14H10N2OS2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 2-thieno[3,2-b]pyridin-6-yl-6,7-dihydro-5H-1,3-benzothiazol-4-one |
| SMILES | O=C1CCCc2sc(-c3cnc4ccsc4c3)nc21 |
| InChI | InChI=1S/C14H10N2OS2/c17-10-2-1-3-11-13(10)16-14(19-11)8-6-12-9(15-7-8)4-5-18-12/h4-7H,1-3H2 |
| InChIKey | VLTGORHKKBRNFN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-thieno[3,2-b]pyridin-6-yl-6,7-dihydro-5H-1,3-benzothiazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thieno[3,2-b]pyridin-6-yl-6,7-dihydro-5H-1,3-benzothiazol-4-one?
The IUPAC name of 2-thieno[3,2-b]pyridin-6-yl-6,7-dihydro-5H-1,3-benzothiazol-4-one (CID 81143321) is 2-thieno[3,2-b]pyridin-6-yl-6,7-dihydro-5H-1,3-benzothiazol-4-one.
What is the SMILES notation for 2-thieno[3,2-b]pyridin-6-yl-6,7-dihydro-5H-1,3-benzothiazol-4-one?
The canonical SMILES for 2-thieno[3,2-b]pyridin-6-yl-6,7-dihydro-5H-1,3-benzothiazol-4-one is O=C1CCCc2sc(-c3cnc4ccsc4c3)nc21.
What is the InChIKey of 2-thieno[3,2-b]pyridin-6-yl-6,7-dihydro-5H-1,3-benzothiazol-4-one?
The InChIKey is VLTGORHKKBRNFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2OS2/c17-10-2-1-3-11-13(10)16-14(19-11)8-6-12-9(15-7-8)4-5-18-12/h4-7H,1-3H2.
What are the key properties of 2-thieno[3,2-b]pyridin-6-yl-6,7-dihydro-5H-1,3-benzothiazol-4-one?
2-thieno[3,2-b]pyridin-6-yl-6,7-dihydro-5H-1,3-benzothiazol-4-one has a molecular weight of 286.38 g/mol, XLogP of 3.94, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thieno[3,2-b]pyridin-6-yl-6,7-dihydro-5H-1,3-benzothiazol-4-one is sourced from PubChem (CID 81143321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).