About 2,2-dimethyl-1-thieno[3,2-b]pyridin-6-ylpropan-1-ol
2,2-dimethyl-1-thieno[3,2-b]pyridin-6-ylpropan-1-ol (PubChem CID 81143466) has the molecular formula C12H15NOS
and a molecular weight of 221.32 g/mol. Its IUPAC name is 2,2-dimethyl-1-thieno[3,2-b]pyridin-6-ylpropan-1-ol.
Molecular Properties
| Compound Name | 2,2-dimethyl-1-thieno[3,2-b]pyridin-6-ylpropan-1-ol |
| PubChem CID | 81143466 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 2,2-dimethyl-1-thieno[3,2-b]pyridin-6-ylpropan-1-ol |
| SMILES | CC(C)(C)C(O)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C12H15NOS/c1-12(2,3)11(14)8-6-10-9(13-7-8)4-5-15-10/h4-7,11,14H,1-3H3 |
| InChIKey | RUQHGUBFKCLVQE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dimethyl-1-thieno[3,2-b]pyridin-6-ylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1-thieno[3,2-b]pyridin-6-ylpropan-1-ol?
The IUPAC name of 2,2-dimethyl-1-thieno[3,2-b]pyridin-6-ylpropan-1-ol (CID 81143466) is 2,2-dimethyl-1-thieno[3,2-b]pyridin-6-ylpropan-1-ol.
What is the SMILES notation for 2,2-dimethyl-1-thieno[3,2-b]pyridin-6-ylpropan-1-ol?
The canonical SMILES for 2,2-dimethyl-1-thieno[3,2-b]pyridin-6-ylpropan-1-ol is CC(C)(C)C(O)c1cnc2ccsc2c1.
What is the InChIKey of 2,2-dimethyl-1-thieno[3,2-b]pyridin-6-ylpropan-1-ol?
The InChIKey is RUQHGUBFKCLVQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NOS/c1-12(2,3)11(14)8-6-10-9(13-7-8)4-5-15-10/h4-7,11,14H,1-3H3.
What are the key properties of 2,2-dimethyl-1-thieno[3,2-b]pyridin-6-ylpropan-1-ol?
2,2-dimethyl-1-thieno[3,2-b]pyridin-6-ylpropan-1-ol has a molecular weight of 221.32 g/mol, XLogP of 3.38, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1-thieno[3,2-b]pyridin-6-ylpropan-1-ol is sourced from PubChem (CID 81143466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).