About (3,5-dimethylcyclohexyl)-thieno[3,2-b]pyridin-6-ylmethanol
(3,5-dimethylcyclohexyl)-thieno[3,2-b]pyridin-6-ylmethanol (PubChem CID 81143484) has the molecular formula C16H21NOS
and a molecular weight of 275.42 g/mol. Its IUPAC name is (3,5-dimethylcyclohexyl)-thieno[3,2-b]pyridin-6-ylmethanol.
Molecular Properties
| Compound Name | (3,5-dimethylcyclohexyl)-thieno[3,2-b]pyridin-6-ylmethanol |
| PubChem CID | 81143484 |
| Molecular Formula | C16H21NOS |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (3,5-dimethylcyclohexyl)-thieno[3,2-b]pyridin-6-ylmethanol |
| SMILES | CC1CC(C)CC(C(O)c2cnc3ccsc3c2)C1 |
| InChI | InChI=1S/C16H21NOS/c1-10-5-11(2)7-12(6-10)16(18)13-8-15-14(17-9-13)3-4-19-15/h3-4,8-12,16,18H,5-7H2,1-2H3 |
| InChIKey | WXWSOCMEFYNHDB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3,5-dimethylcyclohexyl)-thieno[3,2-b]pyridin-6-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethylcyclohexyl)-thieno[3,2-b]pyridin-6-ylmethanol?
The IUPAC name of (3,5-dimethylcyclohexyl)-thieno[3,2-b]pyridin-6-ylmethanol (CID 81143484) is (3,5-dimethylcyclohexyl)-thieno[3,2-b]pyridin-6-ylmethanol.
What is the SMILES notation for (3,5-dimethylcyclohexyl)-thieno[3,2-b]pyridin-6-ylmethanol?
The canonical SMILES for (3,5-dimethylcyclohexyl)-thieno[3,2-b]pyridin-6-ylmethanol is CC1CC(C)CC(C(O)c2cnc3ccsc3c2)C1.
What is the InChIKey of (3,5-dimethylcyclohexyl)-thieno[3,2-b]pyridin-6-ylmethanol?
The InChIKey is WXWSOCMEFYNHDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NOS/c1-10-5-11(2)7-12(6-10)16(18)13-8-15-14(17-9-13)3-4-19-15/h3-4,8-12,16,18H,5-7H2,1-2H3.
What are the key properties of (3,5-dimethylcyclohexyl)-thieno[3,2-b]pyridin-6-ylmethanol?
(3,5-dimethylcyclohexyl)-thieno[3,2-b]pyridin-6-ylmethanol has a molecular weight of 275.42 g/mol, XLogP of 4.40, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethylcyclohexyl)-thieno[3,2-b]pyridin-6-ylmethanol is sourced from PubChem (CID 81143484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).