C13H18N2S — CID 81143575
3-methyl-1-thieno[3,2-b]pyridin-6-ylpentan-1-amine (PubChem CID 81143575) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is 3-methyl-1-thieno[3,2-b]pyridin-6-ylpentan-1-amine.
| Compound Name | 3-methyl-1-thieno[3,2-b]pyridin-6-ylpentan-1-amine |
|---|---|
| PubChem CID | 81143575 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 3-methyl-1-thieno[3,2-b]pyridin-6-ylpentan-1-amine |
| SMILES | CCC(C)CC(N)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C13H18N2S/c1-3-9(2)6-11(14)10-7-13-12(15-8-10)4-5-16-13/h4-5,7-9,11H,3,6,14H2,1-2H3 |
| InChIKey | SMZYSQHRBKTPAT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |