About 2-(5-thieno[3,2-b]pyridin-6-yltetrazol-1-yl)ethanamine
2-(5-thieno[3,2-b]pyridin-6-yltetrazol-1-yl)ethanamine (PubChem CID 81143911) has the molecular formula C10H10N6S
and a molecular weight of 246.30 g/mol. Its IUPAC name is 2-(5-thieno[3,2-b]pyridin-6-yltetrazol-1-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(5-thieno[3,2-b]pyridin-6-yltetrazol-1-yl)ethanamine |
| PubChem CID | 81143911 |
| Molecular Formula | C10H10N6S |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 2-(5-thieno[3,2-b]pyridin-6-yltetrazol-1-yl)ethanamine |
| SMILES | NCCn1nnnc1-c1cnc2ccsc2c1 |
| InChI | InChI=1S/C10H10N6S/c11-2-3-16-10(13-14-15-16)7-5-9-8(12-6-7)1-4-17-9/h1,4-6H,2-3,11H2 |
| InChIKey | UZAJGLWWPVXRTL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(5-thieno[3,2-b]pyridin-6-yltetrazol-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-thieno[3,2-b]pyridin-6-yltetrazol-1-yl)ethanamine?
The IUPAC name of 2-(5-thieno[3,2-b]pyridin-6-yltetrazol-1-yl)ethanamine (CID 81143911) is 2-(5-thieno[3,2-b]pyridin-6-yltetrazol-1-yl)ethanamine.
What is the SMILES notation for 2-(5-thieno[3,2-b]pyridin-6-yltetrazol-1-yl)ethanamine?
The canonical SMILES for 2-(5-thieno[3,2-b]pyridin-6-yltetrazol-1-yl)ethanamine is NCCn1nnnc1-c1cnc2ccsc2c1.
What is the InChIKey of 2-(5-thieno[3,2-b]pyridin-6-yltetrazol-1-yl)ethanamine?
The InChIKey is UZAJGLWWPVXRTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N6S/c11-2-3-16-10(13-14-15-16)7-5-9-8(12-6-7)1-4-17-9/h1,4-6H,2-3,11H2.
What are the key properties of 2-(5-thieno[3,2-b]pyridin-6-yltetrazol-1-yl)ethanamine?
2-(5-thieno[3,2-b]pyridin-6-yltetrazol-1-yl)ethanamine has a molecular weight of 246.30 g/mol, XLogP of 0.91, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-thieno[3,2-b]pyridin-6-yltetrazol-1-yl)ethanamine is sourced from PubChem (CID 81143911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).