C15H16N2S2 — CID 81144170
N-ethyl-1-thieno[3,2-b]pyridin-6-yl-2-thiophen-2-ylethanamine (PubChem CID 81144170) has the molecular formula C15H16N2S2 and a molecular weight of 288.44 g/mol. Its IUPAC name is N-ethyl-1-thieno[3,2-b]pyridin-6-yl-2-thiophen-2-ylethanamine.
| Compound Name | N-ethyl-1-thieno[3,2-b]pyridin-6-yl-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 81144170 |
| Molecular Formula | C15H16N2S2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | N-ethyl-1-thieno[3,2-b]pyridin-6-yl-2-thiophen-2-ylethanamine |
| SMILES | CCNC(Cc1cccs1)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C15H16N2S2/c1-2-16-14(9-12-4-3-6-18-12)11-8-15-13(17-10-11)5-7-19-15/h3-8,10,14,16H,2,9H2,1H3 |
| InChIKey | DZQVOCXTWHOYMM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |