C14H11ClFN3 — CID 81145361
N-[(3-chloro-4-fluorophenyl)methyl]-1H-indazol-7-amine (PubChem CID 81145361) has the molecular formula C14H11ClFN3 and a molecular weight of 275.71 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-1H-indazol-7-amine.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-1H-indazol-7-amine |
|---|---|
| PubChem CID | 81145361 |
| Molecular Formula | C14H11ClFN3 |
| Molecular Weight | 275.71 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-1H-indazol-7-amine |
| SMILES | Fc1ccc(CNc2cccc3cn[nH]c23)cc1Cl |
| InChI | InChI=1S/C14H11ClFN3/c15-11-6-9(4-5-12(11)16)7-17-13-3-1-2-10-8-18-19-14(10)13/h1-6,8,17H,7H2,(H,18,19) |
| InChIKey | OVERMKRFBNOJGP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.71 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |