About 3-chloro-4-(N,4-dimethylanilino)benzaldehyde
3-chloro-4-(N,4-dimethylanilino)benzaldehyde (PubChem CID 81146280) has the molecular formula C15H14ClNO
and a molecular weight of 259.74 g/mol. Its IUPAC name is 3-chloro-4-(N,4-dimethylanilino)benzaldehyde.
Molecular Properties
| Compound Name | 3-chloro-4-(N,4-dimethylanilino)benzaldehyde |
| PubChem CID | 81146280 |
| Molecular Formula | C15H14ClNO |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 3-chloro-4-(N,4-dimethylanilino)benzaldehyde |
| SMILES | Cc1ccc(N(C)c2ccc(C=O)cc2Cl)cc1 |
| InChI | InChI=1S/C15H14ClNO/c1-11-3-6-13(7-4-11)17(2)15-8-5-12(10-18)9-14(15)16/h3-10H,1-2H3 |
| InChIKey | QCUJDHSOQJFYOW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-(N,4-dimethylanilino)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-(N,4-dimethylanilino)benzaldehyde?
The IUPAC name of 3-chloro-4-(N,4-dimethylanilino)benzaldehyde (CID 81146280) is 3-chloro-4-(N,4-dimethylanilino)benzaldehyde.
What is the SMILES notation for 3-chloro-4-(N,4-dimethylanilino)benzaldehyde?
The canonical SMILES for 3-chloro-4-(N,4-dimethylanilino)benzaldehyde is Cc1ccc(N(C)c2ccc(C=O)cc2Cl)cc1.
What is the InChIKey of 3-chloro-4-(N,4-dimethylanilino)benzaldehyde?
The InChIKey is QCUJDHSOQJFYOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClNO/c1-11-3-6-13(7-4-11)17(2)15-8-5-12(10-18)9-14(15)16/h3-10H,1-2H3.
What are the key properties of 3-chloro-4-(N,4-dimethylanilino)benzaldehyde?
3-chloro-4-(N,4-dimethylanilino)benzaldehyde has a molecular weight of 259.74 g/mol, XLogP of 4.23, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-(N,4-dimethylanilino)benzaldehyde is sourced from PubChem (CID 81146280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).