C12H12ClFN2O2 — CID 81146324
3-[(3-chloro-4-fluorophenyl)methylamino]piperidine-2,6-dione (PubChem CID 81146324) has the molecular formula C12H12ClFN2O2 and a molecular weight of 270.69 g/mol. Its IUPAC name is 3-[(3-chloro-4-fluorophenyl)methylamino]piperidine-2,6-dione.
| Compound Name | 3-[(3-chloro-4-fluorophenyl)methylamino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 81146324 |
| Molecular Formula | C12H12ClFN2O2 |
| Molecular Weight | 270.69 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 3-[(3-chloro-4-fluorophenyl)methylamino]piperidine-2,6-dione |
| SMILES | O=C1CCC(NCc2ccc(F)c(Cl)c2)C(=O)N1 |
| InChI | InChI=1S/C12H12ClFN2O2/c13-8-5-7(1-2-9(8)14)6-15-10-3-4-11(17)16-12(10)18/h1-2,5,10,15H,3-4,6H2,(H,16,17,18) |
| InChIKey | RPYDOXOXJUPHCG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.69 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|