C16H21ClN4 — CID 81146399
2-chloro-4-[(cyclopropylamino)methyl]-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]aniline (PubChem CID 81146399) has the molecular formula C16H21ClN4 and a molecular weight of 304.83 g/mol. Its IUPAC name is 2-chloro-4-[(cyclopropylamino)methyl]-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]aniline.
| Compound Name | 2-chloro-4-[(cyclopropylamino)methyl]-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 81146399 |
| Molecular Formula | C16H21ClN4 |
| Molecular Weight | 304.83 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-chloro-4-[(cyclopropylamino)methyl]-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]aniline |
| SMILES | CN(Cc1cnn(C)c1)c1ccc(CNC2CC2)cc1Cl |
| InChI | InChI=1S/C16H21ClN4/c1-20(10-13-9-19-21(2)11-13)16-6-3-12(7-15(16)17)8-18-14-4-5-14/h3,6-7,9,11,14,18H,4-5,8,10H2,1-2H3 |
| InChIKey | MJLLJXKXEOKONS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.83 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|