About 7-bromo-3-(1-bromo-3,5,5-trimethylhexyl)-1-benzothiophene
7-bromo-3-(1-bromo-3,5,5-trimethylhexyl)-1-benzothiophene (PubChem CID 81146415) has the molecular formula C17H22Br2S
and a molecular weight of 418.24 g/mol. Its IUPAC name is 7-bromo-3-(1-bromo-3,5,5-trimethylhexyl)-1-benzothiophene.
Molecular Properties
| Compound Name | 7-bromo-3-(1-bromo-3,5,5-trimethylhexyl)-1-benzothiophene |
| PubChem CID | 81146415 |
| Molecular Formula | C17H22Br2S |
| Molecular Weight | 418.24 g/mol |
| Exact Mass | 415.98 |
| IUPAC Name | 7-bromo-3-(1-bromo-3,5,5-trimethylhexyl)-1-benzothiophene |
| SMILES | CC(CC(Br)c1csc2c(Br)cccc12)CC(C)(C)C |
| InChI | InChI=1S/C17H22Br2S/c1-11(9-17(2,3)4)8-15(19)13-10-20-16-12(13)6-5-7-14(16)18/h5-7,10-11,15H,8-9H2,1-4H3 |
| InChIKey | AXSJDQMWYAADKJ-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.24 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-3-(1-bromo-3,5,5-trimethylhexyl)-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3-(1-bromo-3,5,5-trimethylhexyl)-1-benzothiophene?
The IUPAC name of 7-bromo-3-(1-bromo-3,5,5-trimethylhexyl)-1-benzothiophene (CID 81146415) is 7-bromo-3-(1-bromo-3,5,5-trimethylhexyl)-1-benzothiophene.
What is the SMILES notation for 7-bromo-3-(1-bromo-3,5,5-trimethylhexyl)-1-benzothiophene?
The canonical SMILES for 7-bromo-3-(1-bromo-3,5,5-trimethylhexyl)-1-benzothiophene is CC(CC(Br)c1csc2c(Br)cccc12)CC(C)(C)C.
What is the InChIKey of 7-bromo-3-(1-bromo-3,5,5-trimethylhexyl)-1-benzothiophene?
The InChIKey is AXSJDQMWYAADKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22Br2S/c1-11(9-17(2,3)4)8-15(19)13-10-20-16-12(13)6-5-7-14(16)18/h5-7,10-11,15H,8-9H2,1-4H3.
What are the key properties of 7-bromo-3-(1-bromo-3,5,5-trimethylhexyl)-1-benzothiophene?
7-bromo-3-(1-bromo-3,5,5-trimethylhexyl)-1-benzothiophene has a molecular weight of 418.24 g/mol, XLogP of 7.56, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3-(1-bromo-3,5,5-trimethylhexyl)-1-benzothiophene is sourced from PubChem (CID 81146415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).