About phenyl(thieno[3,2-b]pyridin-6-yl)methanone
phenyl(thieno[3,2-b]pyridin-6-yl)methanone (PubChem CID 81147858) has the molecular formula C14H9NOS
and a molecular weight of 239.30 g/mol. Its IUPAC name is phenyl(thieno[3,2-b]pyridin-6-yl)methanone.
Molecular Properties
| Compound Name | phenyl(thieno[3,2-b]pyridin-6-yl)methanone |
| PubChem CID | 81147858 |
| Molecular Formula | C14H9NOS |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | phenyl(thieno[3,2-b]pyridin-6-yl)methanone |
| SMILES | O=C(c1ccccc1)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C14H9NOS/c16-14(10-4-2-1-3-5-10)11-8-13-12(15-9-11)6-7-17-13/h1-9H |
| InChIKey | DAZUKWOFTKSDAY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenyl(thieno[3,2-b]pyridin-6-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl(thieno[3,2-b]pyridin-6-yl)methanone?
The IUPAC name of phenyl(thieno[3,2-b]pyridin-6-yl)methanone (CID 81147858) is phenyl(thieno[3,2-b]pyridin-6-yl)methanone.
What is the SMILES notation for phenyl(thieno[3,2-b]pyridin-6-yl)methanone?
The canonical SMILES for phenyl(thieno[3,2-b]pyridin-6-yl)methanone is O=C(c1ccccc1)c1cnc2ccsc2c1.
What is the InChIKey of phenyl(thieno[3,2-b]pyridin-6-yl)methanone?
The InChIKey is DAZUKWOFTKSDAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NOS/c16-14(10-4-2-1-3-5-10)11-8-13-12(15-9-11)6-7-17-13/h1-9H.
What are the key properties of phenyl(thieno[3,2-b]pyridin-6-yl)methanone?
phenyl(thieno[3,2-b]pyridin-6-yl)methanone has a molecular weight of 239.30 g/mol, XLogP of 3.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl(thieno[3,2-b]pyridin-6-yl)methanone is sourced from PubChem (CID 81147858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).