About 2-thieno[3,2-b]pyridin-6-yl-7,8-dihydro-6H-quinazolin-5-one
2-thieno[3,2-b]pyridin-6-yl-7,8-dihydro-6H-quinazolin-5-one (PubChem CID 81147875) has the molecular formula C15H11N3OS
and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-thieno[3,2-b]pyridin-6-yl-7,8-dihydro-6H-quinazolin-5-one.
Molecular Properties
| Compound Name | 2-thieno[3,2-b]pyridin-6-yl-7,8-dihydro-6H-quinazolin-5-one |
| PubChem CID | 81147875 |
| Molecular Formula | C15H11N3OS |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2-thieno[3,2-b]pyridin-6-yl-7,8-dihydro-6H-quinazolin-5-one |
| SMILES | O=C1CCCc2nc(-c3cnc4ccsc4c3)ncc21 |
| InChI | InChI=1S/C15H11N3OS/c19-13-3-1-2-11-10(13)8-17-15(18-11)9-6-14-12(16-7-9)4-5-20-14/h4-8H,1-3H2 |
| InChIKey | WIUBIJCSWNZQSZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-thieno[3,2-b]pyridin-6-yl-7,8-dihydro-6H-quinazolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thieno[3,2-b]pyridin-6-yl-7,8-dihydro-6H-quinazolin-5-one?
The IUPAC name of 2-thieno[3,2-b]pyridin-6-yl-7,8-dihydro-6H-quinazolin-5-one (CID 81147875) is 2-thieno[3,2-b]pyridin-6-yl-7,8-dihydro-6H-quinazolin-5-one.
What is the SMILES notation for 2-thieno[3,2-b]pyridin-6-yl-7,8-dihydro-6H-quinazolin-5-one?
The canonical SMILES for 2-thieno[3,2-b]pyridin-6-yl-7,8-dihydro-6H-quinazolin-5-one is O=C1CCCc2nc(-c3cnc4ccsc4c3)ncc21.
What is the InChIKey of 2-thieno[3,2-b]pyridin-6-yl-7,8-dihydro-6H-quinazolin-5-one?
The InChIKey is WIUBIJCSWNZQSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3OS/c19-13-3-1-2-11-10(13)8-17-15(18-11)9-6-14-12(16-7-9)4-5-20-14/h4-8H,1-3H2.
What are the key properties of 2-thieno[3,2-b]pyridin-6-yl-7,8-dihydro-6H-quinazolin-5-one?
2-thieno[3,2-b]pyridin-6-yl-7,8-dihydro-6H-quinazolin-5-one has a molecular weight of 281.34 g/mol, XLogP of 3.27, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thieno[3,2-b]pyridin-6-yl-7,8-dihydro-6H-quinazolin-5-one is sourced from PubChem (CID 81147875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).