C15H15IN4S — CID 81148158
5-iodo-6-methyl-N-propyl-2-thieno[3,2-b]pyridin-6-ylpyrimidin-4-amine (PubChem CID 81148158) has the molecular formula C15H15IN4S and a molecular weight of 410.28 g/mol. Its IUPAC name is 5-iodo-6-methyl-N-propyl-2-thieno[3,2-b]pyridin-6-ylpyrimidin-4-amine.
| Compound Name | 5-iodo-6-methyl-N-propyl-2-thieno[3,2-b]pyridin-6-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 81148158 |
| Molecular Formula | C15H15IN4S |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | 5-iodo-6-methyl-N-propyl-2-thieno[3,2-b]pyridin-6-ylpyrimidin-4-amine |
| SMILES | CCCNc1nc(-c2cnc3ccsc3c2)nc(C)c1I |
| InChI | InChI=1S/C15H15IN4S/c1-3-5-17-15-13(16)9(2)19-14(20-15)10-7-12-11(18-8-10)4-6-21-12/h4,6-8H,3,5H2,1-2H3,(H,17,19,20) |
| InChIKey | DTCRPTVZIYRPPN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|