C17H20BrClN2 — CID 81148254
N-[(3-bromophenyl)methyl]-2-chloro-4-(ethylaminomethyl)-N-methylaniline (PubChem CID 81148254) has the molecular formula C17H20BrClN2 and a molecular weight of 367.72 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-2-chloro-4-(ethylaminomethyl)-N-methylaniline.
| Compound Name | N-[(3-bromophenyl)methyl]-2-chloro-4-(ethylaminomethyl)-N-methylaniline |
|---|---|
| PubChem CID | 81148254 |
| Molecular Formula | C17H20BrClN2 |
| Molecular Weight | 367.72 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-2-chloro-4-(ethylaminomethyl)-N-methylaniline |
| SMILES | CCNCc1ccc(N(C)Cc2cccc(Br)c2)c(Cl)c1 |
| InChI | InChI=1S/C17H20BrClN2/c1-3-20-11-13-7-8-17(16(19)10-13)21(2)12-14-5-4-6-15(18)9-14/h4-10,20H,3,11-12H2,1-2H3 |
| InChIKey | MFBBXEQASBGBLJ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.72 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|