About (4-ethylphenyl)-thieno[3,2-b]pyridin-6-ylmethanone
(4-ethylphenyl)-thieno[3,2-b]pyridin-6-ylmethanone (PubChem CID 81148407) has the molecular formula C16H13NOS
and a molecular weight of 267.35 g/mol. Its IUPAC name is (4-ethylphenyl)-thieno[3,2-b]pyridin-6-ylmethanone.
Molecular Properties
| Compound Name | (4-ethylphenyl)-thieno[3,2-b]pyridin-6-ylmethanone |
| PubChem CID | 81148407 |
| Molecular Formula | C16H13NOS |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | (4-ethylphenyl)-thieno[3,2-b]pyridin-6-ylmethanone |
| SMILES | CCc1ccc(C(=O)c2cnc3ccsc3c2)cc1 |
| InChI | InChI=1S/C16H13NOS/c1-2-11-3-5-12(6-4-11)16(18)13-9-15-14(17-10-13)7-8-19-15/h3-10H,2H2,1H3 |
| InChIKey | FLUGNNAHOAQSJG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-ethylphenyl)-thieno[3,2-b]pyridin-6-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylphenyl)-thieno[3,2-b]pyridin-6-ylmethanone?
The IUPAC name of (4-ethylphenyl)-thieno[3,2-b]pyridin-6-ylmethanone (CID 81148407) is (4-ethylphenyl)-thieno[3,2-b]pyridin-6-ylmethanone.
What is the SMILES notation for (4-ethylphenyl)-thieno[3,2-b]pyridin-6-ylmethanone?
The canonical SMILES for (4-ethylphenyl)-thieno[3,2-b]pyridin-6-ylmethanone is CCc1ccc(C(=O)c2cnc3ccsc3c2)cc1.
What is the InChIKey of (4-ethylphenyl)-thieno[3,2-b]pyridin-6-ylmethanone?
The InChIKey is FLUGNNAHOAQSJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NOS/c1-2-11-3-5-12(6-4-11)16(18)13-9-15-14(17-10-13)7-8-19-15/h3-10H,2H2,1H3.
What are the key properties of (4-ethylphenyl)-thieno[3,2-b]pyridin-6-ylmethanone?
(4-ethylphenyl)-thieno[3,2-b]pyridin-6-ylmethanone has a molecular weight of 267.35 g/mol, XLogP of 4.09, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylphenyl)-thieno[3,2-b]pyridin-6-ylmethanone is sourced from PubChem (CID 81148407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).