C16H23ClN2O — CID 81150118
1-[2-chloro-4-[(cyclopropylamino)methyl]phenyl]-4-methylpiperidin-4-ol (PubChem CID 81150118) has the molecular formula C16H23ClN2O and a molecular weight of 294.83 g/mol. Its IUPAC name is 1-[2-chloro-4-[(cyclopropylamino)methyl]phenyl]-4-methylpiperidin-4-ol.
| Compound Name | 1-[2-chloro-4-[(cyclopropylamino)methyl]phenyl]-4-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 81150118 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 1-[2-chloro-4-[(cyclopropylamino)methyl]phenyl]-4-methylpiperidin-4-ol |
| SMILES | CC1(O)CCN(c2ccc(CNC3CC3)cc2Cl)CC1 |
| InChI | InChI=1S/C16H23ClN2O/c1-16(20)6-8-19(9-7-16)15-5-2-12(10-14(15)17)11-18-13-3-4-13/h2,5,10,13,18,20H,3-4,6-9,11H2,1H3 |
| InChIKey | YPNRWFGIMQVNEL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|