C14H16N2O3S — CID 81150360
N-[(3-methoxy-5-nitrophenyl)methyl]-2-thiophen-3-ylethanamine (PubChem CID 81150360) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is N-[(3-methoxy-5-nitrophenyl)methyl]-2-thiophen-3-ylethanamine.
| Compound Name | N-[(3-methoxy-5-nitrophenyl)methyl]-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 81150360 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | N-[(3-methoxy-5-nitrophenyl)methyl]-2-thiophen-3-ylethanamine |
| SMILES | COc1cc(CNCCc2ccsc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H16N2O3S/c1-19-14-7-12(6-13(8-14)16(17)18)9-15-4-2-11-3-5-20-10-11/h3,5-8,10,15H,2,4,9H2,1H3 |
| InChIKey | YFELTGFIFVYCRD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|