C14H20N4O — CID 81150679
3-[(3,5-diethyl-1,2,4-triazol-1-yl)methyl]-5-methoxyaniline (PubChem CID 81150679) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 3-[(3,5-diethyl-1,2,4-triazol-1-yl)methyl]-5-methoxyaniline.
| Compound Name | 3-[(3,5-diethyl-1,2,4-triazol-1-yl)methyl]-5-methoxyaniline |
|---|---|
| PubChem CID | 81150679 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 3-[(3,5-diethyl-1,2,4-triazol-1-yl)methyl]-5-methoxyaniline |
| SMILES | CCc1nc(CC)n(Cc2cc(N)cc(OC)c2)n1 |
| InChI | InChI=1S/C14H20N4O/c1-4-13-16-14(5-2)18(17-13)9-10-6-11(15)8-12(7-10)19-3/h6-8H,4-5,9,15H2,1-3H3 |
| InChIKey | FWZJAUYDEAFFMX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|