C15H23Cl2N — CID 81151646
N-butan-2-yl-N-butyl-2-chloro-4-(chloromethyl)aniline (PubChem CID 81151646) has the molecular formula C15H23Cl2N and a molecular weight of 288.26 g/mol. Its IUPAC name is N-butan-2-yl-N-butyl-2-chloro-4-(chloromethyl)aniline.
| Compound Name | N-butan-2-yl-N-butyl-2-chloro-4-(chloromethyl)aniline |
|---|---|
| PubChem CID | 81151646 |
| Molecular Formula | C15H23Cl2N |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | N-butan-2-yl-N-butyl-2-chloro-4-(chloromethyl)aniline |
| SMILES | CCCCN(c1ccc(CCl)cc1Cl)C(C)CC |
| InChI | InChI=1S/C15H23Cl2N/c1-4-6-9-18(12(3)5-2)15-8-7-13(11-16)10-14(15)17/h7-8,10,12H,4-6,9,11H2,1-3H3 |
| InChIKey | ZCHKYNNLNAPFRH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|