About naphthalen-2-yl(thieno[3,2-b]pyridin-6-yl)methanone
naphthalen-2-yl(thieno[3,2-b]pyridin-6-yl)methanone (PubChem CID 81153173) has the molecular formula C18H11NOS
and a molecular weight of 289.36 g/mol. Its IUPAC name is naphthalen-2-yl(thieno[3,2-b]pyridin-6-yl)methanone.
Molecular Properties
| Compound Name | naphthalen-2-yl(thieno[3,2-b]pyridin-6-yl)methanone |
| PubChem CID | 81153173 |
| Molecular Formula | C18H11NOS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | naphthalen-2-yl(thieno[3,2-b]pyridin-6-yl)methanone |
| SMILES | O=C(c1ccc2ccccc2c1)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C18H11NOS/c20-18(15-10-17-16(19-11-15)7-8-21-17)14-6-5-12-3-1-2-4-13(12)9-14/h1-11H |
| InChIKey | GMDSIRTXOQMCER-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze naphthalen-2-yl(thieno[3,2-b]pyridin-6-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-2-yl(thieno[3,2-b]pyridin-6-yl)methanone?
The IUPAC name of naphthalen-2-yl(thieno[3,2-b]pyridin-6-yl)methanone (CID 81153173) is naphthalen-2-yl(thieno[3,2-b]pyridin-6-yl)methanone.
What is the SMILES notation for naphthalen-2-yl(thieno[3,2-b]pyridin-6-yl)methanone?
The canonical SMILES for naphthalen-2-yl(thieno[3,2-b]pyridin-6-yl)methanone is O=C(c1ccc2ccccc2c1)c1cnc2ccsc2c1.
What is the InChIKey of naphthalen-2-yl(thieno[3,2-b]pyridin-6-yl)methanone?
The InChIKey is GMDSIRTXOQMCER-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11NOS/c20-18(15-10-17-16(19-11-15)7-8-21-17)14-6-5-12-3-1-2-4-13(12)9-14/h1-11H.
What are the key properties of naphthalen-2-yl(thieno[3,2-b]pyridin-6-yl)methanone?
naphthalen-2-yl(thieno[3,2-b]pyridin-6-yl)methanone has a molecular weight of 289.36 g/mol, XLogP of 4.68, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-2-yl(thieno[3,2-b]pyridin-6-yl)methanone is sourced from PubChem (CID 81153173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).