About 1-benzothiophen-7-yl-(3,4,5-trifluorophenyl)methanone
1-benzothiophen-7-yl-(3,4,5-trifluorophenyl)methanone (PubChem CID 81153538) has the molecular formula C15H7F3OS
and a molecular weight of 292.28 g/mol. Its IUPAC name is 1-benzothiophen-7-yl-(3,4,5-trifluorophenyl)methanone.
Molecular Properties
| Compound Name | 1-benzothiophen-7-yl-(3,4,5-trifluorophenyl)methanone |
| PubChem CID | 81153538 |
| Molecular Formula | C15H7F3OS |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 1-benzothiophen-7-yl-(3,4,5-trifluorophenyl)methanone |
| SMILES | O=C(c1cc(F)c(F)c(F)c1)c1cccc2ccsc12 |
| InChI | InChI=1S/C15H7F3OS/c16-11-6-9(7-12(17)13(11)18)14(19)10-3-1-2-8-4-5-20-15(8)10/h1-7H |
| InChIKey | LRTZBLLSHPPBAV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-benzothiophen-7-yl-(3,4,5-trifluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophen-7-yl-(3,4,5-trifluorophenyl)methanone?
The IUPAC name of 1-benzothiophen-7-yl-(3,4,5-trifluorophenyl)methanone (CID 81153538) is 1-benzothiophen-7-yl-(3,4,5-trifluorophenyl)methanone.
What is the SMILES notation for 1-benzothiophen-7-yl-(3,4,5-trifluorophenyl)methanone?
The canonical SMILES for 1-benzothiophen-7-yl-(3,4,5-trifluorophenyl)methanone is O=C(c1cc(F)c(F)c(F)c1)c1cccc2ccsc12.
What is the InChIKey of 1-benzothiophen-7-yl-(3,4,5-trifluorophenyl)methanone?
The InChIKey is LRTZBLLSHPPBAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7F3OS/c16-11-6-9(7-12(17)13(11)18)14(19)10-3-1-2-8-4-5-20-15(8)10/h1-7H.
What are the key properties of 1-benzothiophen-7-yl-(3,4,5-trifluorophenyl)methanone?
1-benzothiophen-7-yl-(3,4,5-trifluorophenyl)methanone has a molecular weight of 292.28 g/mol, XLogP of 4.55, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophen-7-yl-(3,4,5-trifluorophenyl)methanone is sourced from PubChem (CID 81153538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).