C15H17N3S — CID 81153707
N-[1-benzothiophen-7-yl-(1-methylpyrazol-4-yl)methyl]ethanamine (PubChem CID 81153707) has the molecular formula C15H17N3S and a molecular weight of 271.39 g/mol. Its IUPAC name is N-[1-benzothiophen-7-yl-(1-methylpyrazol-4-yl)methyl]ethanamine.
| Compound Name | N-[1-benzothiophen-7-yl-(1-methylpyrazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 81153707 |
| Molecular Formula | C15H17N3S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | N-[1-benzothiophen-7-yl-(1-methylpyrazol-4-yl)methyl]ethanamine |
| SMILES | CCNC(c1cnn(C)c1)c1cccc2ccsc12 |
| InChI | InChI=1S/C15H17N3S/c1-3-16-14(12-9-17-18(2)10-12)13-6-4-5-11-7-8-19-15(11)13/h4-10,14,16H,3H2,1-2H3 |
| InChIKey | FFOLGTQGQALDSE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |