About methyl 4-amino-4-(3,5-dimethylthiophen-2-yl)-2,2-dimethylbutanoate
methyl 4-amino-4-(3,5-dimethylthiophen-2-yl)-2,2-dimethylbutanoate (PubChem CID 81156054) has the molecular formula C13H21NO2S
and a molecular weight of 255.38 g/mol. Its IUPAC name is methyl 4-amino-4-(3,5-dimethylthiophen-2-yl)-2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | methyl 4-amino-4-(3,5-dimethylthiophen-2-yl)-2,2-dimethylbutanoate |
| PubChem CID | 81156054 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | methyl 4-amino-4-(3,5-dimethylthiophen-2-yl)-2,2-dimethylbutanoate |
| SMILES | COC(=O)C(C)(C)CC(N)c1sc(C)cc1C |
| InChI | InChI=1S/C13H21NO2S/c1-8-6-9(2)17-11(8)10(14)7-13(3,4)12(15)16-5/h6,10H,7,14H2,1-5H3 |
| InChIKey | LTMXTHVAXKMXQA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-amino-4-(3,5-dimethylthiophen-2-yl)-2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-amino-4-(3,5-dimethylthiophen-2-yl)-2,2-dimethylbutanoate?
The IUPAC name of methyl 4-amino-4-(3,5-dimethylthiophen-2-yl)-2,2-dimethylbutanoate (CID 81156054) is methyl 4-amino-4-(3,5-dimethylthiophen-2-yl)-2,2-dimethylbutanoate.
What is the SMILES notation for methyl 4-amino-4-(3,5-dimethylthiophen-2-yl)-2,2-dimethylbutanoate?
The canonical SMILES for methyl 4-amino-4-(3,5-dimethylthiophen-2-yl)-2,2-dimethylbutanoate is COC(=O)C(C)(C)CC(N)c1sc(C)cc1C.
What is the InChIKey of methyl 4-amino-4-(3,5-dimethylthiophen-2-yl)-2,2-dimethylbutanoate?
The InChIKey is LTMXTHVAXKMXQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO2S/c1-8-6-9(2)17-11(8)10(14)7-13(3,4)12(15)16-5/h6,10H,7,14H2,1-5H3.
What are the key properties of methyl 4-amino-4-(3,5-dimethylthiophen-2-yl)-2,2-dimethylbutanoate?
methyl 4-amino-4-(3,5-dimethylthiophen-2-yl)-2,2-dimethylbutanoate has a molecular weight of 255.38 g/mol, XLogP of 2.95, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-4-(3,5-dimethylthiophen-2-yl)-2,2-dimethylbutanoate is sourced from PubChem (CID 81156054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).