About 1-[[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methylamino]cyclobutane-1-carboxylic acid
1-[[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methylamino]cyclobutane-1-carboxylic acid (PubChem CID 81156261) has the molecular formula C14H14FN3O3
and a molecular weight of 291.28 g/mol. Its IUPAC name is 1-[[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methylamino]cyclobutane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methylamino]cyclobutane-1-carboxylic acid |
| PubChem CID | 81156261 |
| Molecular Formula | C14H14FN3O3 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 1-[[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methylamino]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(NCc2noc(-c3ccc(F)cc3)n2)CCC1 |
| InChI | InChI=1S/C14H14FN3O3/c15-10-4-2-9(3-5-10)12-17-11(18-21-12)8-16-14(13(19)20)6-1-7-14/h2-5,16H,1,6-8H2,(H,19,20) |
| InChIKey | XGXLRORVTLQLBX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methylamino]cyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methylamino]cyclobutane-1-carboxylic acid?
The IUPAC name of 1-[[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methylamino]cyclobutane-1-carboxylic acid (CID 81156261) is 1-[[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methylamino]cyclobutane-1-carboxylic acid.
What is the SMILES notation for 1-[[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methylamino]cyclobutane-1-carboxylic acid?
The canonical SMILES for 1-[[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methylamino]cyclobutane-1-carboxylic acid is O=C(O)C1(NCc2noc(-c3ccc(F)cc3)n2)CCC1.
What is the InChIKey of 1-[[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methylamino]cyclobutane-1-carboxylic acid?
The InChIKey is XGXLRORVTLQLBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14FN3O3/c15-10-4-2-9(3-5-10)12-17-11(18-21-12)8-16-14(13(19)20)6-1-7-14/h2-5,16H,1,6-8H2,(H,19,20).
What are the key properties of 1-[[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methylamino]cyclobutane-1-carboxylic acid?
1-[[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methylamino]cyclobutane-1-carboxylic acid has a molecular weight of 291.28 g/mol, XLogP of 1.97, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methylamino]cyclobutane-1-carboxylic acid is sourced from PubChem (CID 81156261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).