About 7-naphthalen-1-yl-5,7-diazaspiro[3.4]octane-6,8-dione
7-naphthalen-1-yl-5,7-diazaspiro[3.4]octane-6,8-dione (PubChem CID 81156365) has the molecular formula C16H14N2O2
and a molecular weight of 266.30 g/mol. Its IUPAC name is 7-naphthalen-1-yl-5,7-diazaspiro[3.4]octane-6,8-dione.
Molecular Properties
| Compound Name | 7-naphthalen-1-yl-5,7-diazaspiro[3.4]octane-6,8-dione |
| PubChem CID | 81156365 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 7-naphthalen-1-yl-5,7-diazaspiro[3.4]octane-6,8-dione |
| SMILES | O=C1NC2(CCC2)C(=O)N1c1cccc2ccccc12 |
| InChI | InChI=1S/C16H14N2O2/c19-14-16(9-4-10-16)17-15(20)18(14)13-8-3-6-11-5-1-2-7-12(11)13/h1-3,5-8H,4,9-10H2,(H,17,20) |
| InChIKey | ZZVWVLZDAHLMRK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 7-naphthalen-1-yl-5,7-diazaspiro[3.4]octane-6,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-naphthalen-1-yl-5,7-diazaspiro[3.4]octane-6,8-dione?
The IUPAC name of 7-naphthalen-1-yl-5,7-diazaspiro[3.4]octane-6,8-dione (CID 81156365) is 7-naphthalen-1-yl-5,7-diazaspiro[3.4]octane-6,8-dione.
What is the SMILES notation for 7-naphthalen-1-yl-5,7-diazaspiro[3.4]octane-6,8-dione?
The canonical SMILES for 7-naphthalen-1-yl-5,7-diazaspiro[3.4]octane-6,8-dione is O=C1NC2(CCC2)C(=O)N1c1cccc2ccccc12.
What is the InChIKey of 7-naphthalen-1-yl-5,7-diazaspiro[3.4]octane-6,8-dione?
The InChIKey is ZZVWVLZDAHLMRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O2/c19-14-16(9-4-10-16)17-15(20)18(14)13-8-3-6-11-5-1-2-7-12(11)13/h1-3,5-8H,4,9-10H2,(H,17,20).
What are the key properties of 7-naphthalen-1-yl-5,7-diazaspiro[3.4]octane-6,8-dione?
7-naphthalen-1-yl-5,7-diazaspiro[3.4]octane-6,8-dione has a molecular weight of 266.30 g/mol, XLogP of 2.82, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-naphthalen-1-yl-5,7-diazaspiro[3.4]octane-6,8-dione is sourced from PubChem (CID 81156365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).