About 5-(3,5-dimethylthiophen-2-yl)-3-methylpentan-1-amine
5-(3,5-dimethylthiophen-2-yl)-3-methylpentan-1-amine (PubChem CID 81157828) has the molecular formula C12H21NS
and a molecular weight of 211.37 g/mol. Its IUPAC name is 5-(3,5-dimethylthiophen-2-yl)-3-methylpentan-1-amine.
Molecular Properties
| Compound Name | 5-(3,5-dimethylthiophen-2-yl)-3-methylpentan-1-amine |
| PubChem CID | 81157828 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 5-(3,5-dimethylthiophen-2-yl)-3-methylpentan-1-amine |
| SMILES | Cc1cc(C)c(CCC(C)CCN)s1 |
| InChI | InChI=1S/C12H21NS/c1-9(6-7-13)4-5-12-10(2)8-11(3)14-12/h8-9H,4-7,13H2,1-3H3 |
| InChIKey | RMLVMFWTUUTUKR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(3,5-dimethylthiophen-2-yl)-3-methylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-dimethylthiophen-2-yl)-3-methylpentan-1-amine?
The IUPAC name of 5-(3,5-dimethylthiophen-2-yl)-3-methylpentan-1-amine (CID 81157828) is 5-(3,5-dimethylthiophen-2-yl)-3-methylpentan-1-amine.
What is the SMILES notation for 5-(3,5-dimethylthiophen-2-yl)-3-methylpentan-1-amine?
The canonical SMILES for 5-(3,5-dimethylthiophen-2-yl)-3-methylpentan-1-amine is Cc1cc(C)c(CCC(C)CCN)s1.
What is the InChIKey of 5-(3,5-dimethylthiophen-2-yl)-3-methylpentan-1-amine?
The InChIKey is RMLVMFWTUUTUKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NS/c1-9(6-7-13)4-5-12-10(2)8-11(3)14-12/h8-9H,4-7,13H2,1-3H3.
What are the key properties of 5-(3,5-dimethylthiophen-2-yl)-3-methylpentan-1-amine?
5-(3,5-dimethylthiophen-2-yl)-3-methylpentan-1-amine has a molecular weight of 211.37 g/mol, XLogP of 3.28, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dimethylthiophen-2-yl)-3-methylpentan-1-amine is sourced from PubChem (CID 81157828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).