About 2-(1-chloro-2,2-dimethylpropyl)-3,5-dimethylthiophene
2-(1-chloro-2,2-dimethylpropyl)-3,5-dimethylthiophene (PubChem CID 81157902) has the molecular formula C11H17ClS
and a molecular weight of 216.78 g/mol. Its IUPAC name is 2-(1-chloro-2,2-dimethylpropyl)-3,5-dimethylthiophene.
Molecular Properties
| Compound Name | 2-(1-chloro-2,2-dimethylpropyl)-3,5-dimethylthiophene |
| PubChem CID | 81157902 |
| Molecular Formula | C11H17ClS |
| Molecular Weight | 216.78 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 2-(1-chloro-2,2-dimethylpropyl)-3,5-dimethylthiophene |
| SMILES | Cc1cc(C)c(C(Cl)C(C)(C)C)s1 |
| InChI | InChI=1S/C11H17ClS/c1-7-6-8(2)13-9(7)10(12)11(3,4)5/h6,10H,1-5H3 |
| InChIKey | AYMMNYCFNUWTNO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.78 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-chloro-2,2-dimethylpropyl)-3,5-dimethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-chloro-2,2-dimethylpropyl)-3,5-dimethylthiophene?
The IUPAC name of 2-(1-chloro-2,2-dimethylpropyl)-3,5-dimethylthiophene (CID 81157902) is 2-(1-chloro-2,2-dimethylpropyl)-3,5-dimethylthiophene.
What is the SMILES notation for 2-(1-chloro-2,2-dimethylpropyl)-3,5-dimethylthiophene?
The canonical SMILES for 2-(1-chloro-2,2-dimethylpropyl)-3,5-dimethylthiophene is Cc1cc(C)c(C(Cl)C(C)(C)C)s1.
What is the InChIKey of 2-(1-chloro-2,2-dimethylpropyl)-3,5-dimethylthiophene?
The InChIKey is AYMMNYCFNUWTNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClS/c1-7-6-8(2)13-9(7)10(12)11(3,4)5/h6,10H,1-5H3.
What are the key properties of 2-(1-chloro-2,2-dimethylpropyl)-3,5-dimethylthiophene?
2-(1-chloro-2,2-dimethylpropyl)-3,5-dimethylthiophene has a molecular weight of 216.78 g/mol, XLogP of 4.69, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-chloro-2,2-dimethylpropyl)-3,5-dimethylthiophene is sourced from PubChem (CID 81157902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).