About 3-[chloro-(3,5-dimethylthiophen-2-yl)methyl]furan
3-[chloro-(3,5-dimethylthiophen-2-yl)methyl]furan (PubChem CID 81158093) has the molecular formula C11H11ClOS
and a molecular weight of 226.73 g/mol. Its IUPAC name is 3-[chloro-(3,5-dimethylthiophen-2-yl)methyl]furan.
Molecular Properties
| Compound Name | 3-[chloro-(3,5-dimethylthiophen-2-yl)methyl]furan |
| PubChem CID | 81158093 |
| Molecular Formula | C11H11ClOS |
| Molecular Weight | 226.73 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | 3-[chloro-(3,5-dimethylthiophen-2-yl)methyl]furan |
| SMILES | Cc1cc(C)c(C(Cl)c2ccoc2)s1 |
| InChI | InChI=1S/C11H11ClOS/c1-7-5-8(2)14-11(7)10(12)9-3-4-13-6-9/h3-6,10H,1-2H3 |
| InChIKey | YTRIWTAWVAISMA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.73 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[chloro-(3,5-dimethylthiophen-2-yl)methyl]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[chloro-(3,5-dimethylthiophen-2-yl)methyl]furan?
The IUPAC name of 3-[chloro-(3,5-dimethylthiophen-2-yl)methyl]furan (CID 81158093) is 3-[chloro-(3,5-dimethylthiophen-2-yl)methyl]furan.
What is the SMILES notation for 3-[chloro-(3,5-dimethylthiophen-2-yl)methyl]furan?
The canonical SMILES for 3-[chloro-(3,5-dimethylthiophen-2-yl)methyl]furan is Cc1cc(C)c(C(Cl)c2ccoc2)s1.
What is the InChIKey of 3-[chloro-(3,5-dimethylthiophen-2-yl)methyl]furan?
The InChIKey is YTRIWTAWVAISMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClOS/c1-7-5-8(2)14-11(7)10(12)9-3-4-13-6-9/h3-6,10H,1-2H3.
What are the key properties of 3-[chloro-(3,5-dimethylthiophen-2-yl)methyl]furan?
3-[chloro-(3,5-dimethylthiophen-2-yl)methyl]furan has a molecular weight of 226.73 g/mol, XLogP of 4.29, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[chloro-(3,5-dimethylthiophen-2-yl)methyl]furan is sourced from PubChem (CID 81158093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).