About 2-[1-bromo-2-(2,3-difluorophenyl)ethyl]-3,5-dimethylthiophene
2-[1-bromo-2-(2,3-difluorophenyl)ethyl]-3,5-dimethylthiophene (PubChem CID 81158192) has the molecular formula C14H13BrF2S
and a molecular weight of 331.23 g/mol. Its IUPAC name is 2-[1-bromo-2-(2,3-difluorophenyl)ethyl]-3,5-dimethylthiophene.
Molecular Properties
| Compound Name | 2-[1-bromo-2-(2,3-difluorophenyl)ethyl]-3,5-dimethylthiophene |
| PubChem CID | 81158192 |
| Molecular Formula | C14H13BrF2S |
| Molecular Weight | 331.23 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 2-[1-bromo-2-(2,3-difluorophenyl)ethyl]-3,5-dimethylthiophene |
| SMILES | Cc1cc(C)c(C(Br)Cc2cccc(F)c2F)s1 |
| InChI | InChI=1S/C14H13BrF2S/c1-8-6-9(2)18-14(8)11(15)7-10-4-3-5-12(16)13(10)17/h3-6,11H,7H2,1-2H3 |
| InChIKey | XBGPKZGXWBEGSA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.23 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-bromo-2-(2,3-difluorophenyl)ethyl]-3,5-dimethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-bromo-2-(2,3-difluorophenyl)ethyl]-3,5-dimethylthiophene?
The IUPAC name of 2-[1-bromo-2-(2,3-difluorophenyl)ethyl]-3,5-dimethylthiophene (CID 81158192) is 2-[1-bromo-2-(2,3-difluorophenyl)ethyl]-3,5-dimethylthiophene.
What is the SMILES notation for 2-[1-bromo-2-(2,3-difluorophenyl)ethyl]-3,5-dimethylthiophene?
The canonical SMILES for 2-[1-bromo-2-(2,3-difluorophenyl)ethyl]-3,5-dimethylthiophene is Cc1cc(C)c(C(Br)Cc2cccc(F)c2F)s1.
What is the InChIKey of 2-[1-bromo-2-(2,3-difluorophenyl)ethyl]-3,5-dimethylthiophene?
The InChIKey is XBGPKZGXWBEGSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrF2S/c1-8-6-9(2)18-14(8)11(15)7-10-4-3-5-12(16)13(10)17/h3-6,11H,7H2,1-2H3.
What are the key properties of 2-[1-bromo-2-(2,3-difluorophenyl)ethyl]-3,5-dimethylthiophene?
2-[1-bromo-2-(2,3-difluorophenyl)ethyl]-3,5-dimethylthiophene has a molecular weight of 331.23 g/mol, XLogP of 5.32, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-bromo-2-(2,3-difluorophenyl)ethyl]-3,5-dimethylthiophene is sourced from PubChem (CID 81158192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).