C13H13FOS — CID 81158529
(3,5-dimethylthiophen-2-yl)-(2-fluorophenyl)methanol (PubChem CID 81158529) has the molecular formula C13H13FOS and a molecular weight of 236.31 g/mol. Its IUPAC name is (3,5-dimethylthiophen-2-yl)-(2-fluorophenyl)methanol.
| Compound Name | (3,5-dimethylthiophen-2-yl)-(2-fluorophenyl)methanol |
|---|---|
| PubChem CID | 81158529 |
| Molecular Formula | C13H13FOS |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | (3,5-dimethylthiophen-2-yl)-(2-fluorophenyl)methanol |
| SMILES | Cc1cc(C)c(C(O)c2ccccc2F)s1 |
| InChI | InChI=1S/C13H13FOS/c1-8-7-9(2)16-13(8)12(15)10-5-3-4-6-11(10)14/h3-7,12,15H,1-2H3 |
| InChIKey | MTFFVUAAJFOMTD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |