C14H14BrClOS — CID 81158564
2-[bromo-(4-chloro-2-methoxyphenyl)methyl]-3,5-dimethylthiophene (PubChem CID 81158564) has the molecular formula C14H14BrClOS and a molecular weight of 345.69 g/mol. Its IUPAC name is 2-[bromo-(4-chloro-2-methoxyphenyl)methyl]-3,5-dimethylthiophene.
| Compound Name | 2-[bromo-(4-chloro-2-methoxyphenyl)methyl]-3,5-dimethylthiophene |
|---|---|
| PubChem CID | 81158564 |
| Molecular Formula | C14H14BrClOS |
| Molecular Weight | 345.69 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | 2-[bromo-(4-chloro-2-methoxyphenyl)methyl]-3,5-dimethylthiophene |
| SMILES | COc1cc(Cl)ccc1C(Br)c1sc(C)cc1C |
| InChI | InChI=1S/C14H14BrClOS/c1-8-6-9(2)18-14(8)13(15)11-5-4-10(16)7-12(11)17-3/h4-7,13H,1-3H3 |
| InChIKey | HYZJIQFYAIXPKX-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.69 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|