C12H13F2NO4S — CID 81158697
1-[[5-(difluoromethylsulfanylmethyl)furan-2-carbonyl]amino]cyclobutane-1-carboxylic acid (PubChem CID 81158697) has the molecular formula C12H13F2NO4S and a molecular weight of 305.30 g/mol. Its IUPAC name is 1-[[5-(difluoromethylsulfanylmethyl)furan-2-carbonyl]amino]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[[5-(difluoromethylsulfanylmethyl)furan-2-carbonyl]amino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 81158697 |
| Molecular Formula | C12H13F2NO4S |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 1-[[5-(difluoromethylsulfanylmethyl)furan-2-carbonyl]amino]cyclobutane-1-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCC1)c1ccc(CSC(F)F)o1 |
| InChI | InChI=1S/C12H13F2NO4S/c13-11(14)20-6-7-2-3-8(19-7)9(16)15-12(10(17)18)4-1-5-12/h2-3,11H,1,4-6H2,(H,15,16)(H,17,18) |
| InChIKey | XGHXHMYQHJWVGU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |