C11H17NO3 — CID 81158706
1-(cyclopentanecarbonylamino)cyclobutane-1-carboxylic acid (PubChem CID 81158706) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 1-(cyclopentanecarbonylamino)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(cyclopentanecarbonylamino)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 81158706 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 1-(cyclopentanecarbonylamino)cyclobutane-1-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCC1)C1CCCC1 |
| InChI | InChI=1S/C11H17NO3/c13-9(8-4-1-2-5-8)12-11(10(14)15)6-3-7-11/h8H,1-7H2,(H,12,13)(H,14,15) |
| InChIKey | SDXOHWQTKMKBBA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |