About 1-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]cyclobutane-1-carboxylic acid
1-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]cyclobutane-1-carboxylic acid (PubChem CID 81158895) has the molecular formula C13H17N3O4
and a molecular weight of 279.30 g/mol. Its IUPAC name is 1-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]cyclobutane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]cyclobutane-1-carboxylic acid |
| PubChem CID | 81158895 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 1-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]cyclobutane-1-carboxylic acid |
| SMILES | Cc1nc(=O)[nH]c(C)c1CC(=O)NC1(C(=O)O)CCC1 |
| InChI | InChI=1S/C13H17N3O4/c1-7-9(8(2)15-12(20)14-7)6-10(17)16-13(11(18)19)4-3-5-13/h3-6H2,1-2H3,(H,16,17)(H,18,19)(H,14,15,20) |
| InChIKey | JZLVECKGMSXLNL-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]cyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]cyclobutane-1-carboxylic acid?
The IUPAC name of 1-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]cyclobutane-1-carboxylic acid (CID 81158895) is 1-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]cyclobutane-1-carboxylic acid.
What is the SMILES notation for 1-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]cyclobutane-1-carboxylic acid?
The canonical SMILES for 1-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]cyclobutane-1-carboxylic acid is Cc1nc(=O)[nH]c(C)c1CC(=O)NC1(C(=O)O)CCC1.
What is the InChIKey of 1-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]cyclobutane-1-carboxylic acid?
The InChIKey is JZLVECKGMSXLNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O4/c1-7-9(8(2)15-12(20)14-7)6-10(17)16-13(11(18)19)4-3-5-13/h3-6H2,1-2H3,(H,16,17)(H,18,19)(H,14,15,20).
What are the key properties of 1-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]cyclobutane-1-carboxylic acid?
1-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]cyclobutane-1-carboxylic acid has a molecular weight of 279.30 g/mol, XLogP of 0.05, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]cyclobutane-1-carboxylic acid is sourced from PubChem (CID 81158895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).