C11H11ClN4OS — CID 81160433
[3-chloro-4-(4,6-diaminopyrimidin-2-yl)sulfanylphenyl]methanol (PubChem CID 81160433) has the molecular formula C11H11ClN4OS and a molecular weight of 282.76 g/mol. Its IUPAC name is [3-chloro-4-(4,6-diaminopyrimidin-2-yl)sulfanylphenyl]methanol.
| Compound Name | [3-chloro-4-(4,6-diaminopyrimidin-2-yl)sulfanylphenyl]methanol |
|---|---|
| PubChem CID | 81160433 |
| Molecular Formula | C11H11ClN4OS |
| Molecular Weight | 282.76 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | [3-chloro-4-(4,6-diaminopyrimidin-2-yl)sulfanylphenyl]methanol |
| SMILES | Nc1cc(N)nc(Sc2ccc(CO)cc2Cl)n1 |
| InChI | InChI=1S/C11H11ClN4OS/c12-7-3-6(5-17)1-2-8(7)18-11-15-9(13)4-10(14)16-11/h1-4,17H,5H2,(H4,13,14,15,16) |
| InChIKey | YTHPFAASDNQDQR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.76 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |