C7H12N2O3 — CID 81162026
1-(methylcarbamoylamino)cyclobutane-1-carboxylic acid (PubChem CID 81162026) has the molecular formula C7H12N2O3 and a molecular weight of 172.18 g/mol. Its IUPAC name is 1-(methylcarbamoylamino)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(methylcarbamoylamino)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 81162026 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 1-(methylcarbamoylamino)cyclobutane-1-carboxylic acid |
| SMILES | CNC(=O)NC1(C(=O)O)CCC1 |
| InChI | InChI=1S/C7H12N2O3/c1-8-6(12)9-7(5(10)11)3-2-4-7/h2-4H2,1H3,(H,10,11)(H2,8,9,12) |
| InChIKey | DRAMSNPLXVUGPK-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |