C12H16N4O4 — CID 81162036
2-[1-[[(6-amino-5-nitro-2-pyridinyl)amino]methyl]cyclobutyl]acetic acid (PubChem CID 81162036) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-[1-[[(6-amino-5-nitro-2-pyridinyl)amino]methyl]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[[(6-amino-5-nitro-2-pyridinyl)amino]methyl]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 81162036 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-[1-[[(6-amino-5-nitro-2-pyridinyl)amino]methyl]cyclobutyl]acetic acid |
| SMILES | Nc1nc(NCC2(CC(=O)O)CCC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16N4O4/c13-11-8(16(19)20)2-3-9(15-11)14-7-12(4-1-5-12)6-10(17)18/h2-3H,1,4-7H2,(H,17,18)(H3,13,14,15) |
| InChIKey | FYZSOVXBDHVKNZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 131.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|